CAS 1219804-78-0 appears in our catalog under these names: 4-n-Butylanisole-2,3,5,6-d4, 98 atom % D, min 98% Chemical Purity, 4-n-Butylanisole-2,3,5,6-d4. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 1 mg.
1-butyl-2,3,5,6-tetradeuterio-4-methoxybenzene (CAS 1219804-78-0) is a chemical compound with the molecular formula C11H16O and a molecular weight of 168.27 g/mol. IUPAC name: 1-butyl-2,3,5,6-tetradeuterio-4-methoxybenzene. InChIKey: PRBLRGZSVKMPDX-YKVCKAMESA-N.
| Molecular formula | C11H16O |
|---|---|
| Molecular weight | 168.27 g/mol |
| IUPAC name | 1-butyl-2,3,5,6-tetradeuterio-4-methoxybenzene |
| InChIKey | PRBLRGZSVKMPDX-YKVCKAMESA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1CCCC)[2H])[2H])OC)[2H] |
Computed by PubChem (NCBI)