Products 1219804-86-0
CAS 1219804-86-0 appears in our catalog under these names: 4-Chloroanisole-2,3,5,6-d4, 99 atom % D, min 98% Chemical Purity, 1-Chloro-4-methoxybenzene-d4. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 1 mg.
1-chloro-2,3,5,6-tetradeuterio-4-methoxybenzene (CAS 1219804-86-0) is a chemical compound with the molecular formula C7H7ClO and a molecular weight of 146.61 g/mol. IUPAC name: 1-chloro-2,3,5,6-tetradeuterio-4-methoxybenzene. InChIKey: YRGAYAGBVIXNAQ-QFFDRWTDSA-N.
| Molecular formula | C7H7ClO |
|---|---|
| Molecular weight | 146.61 g/mol |
| IUPAC name | 1-chloro-2,3,5,6-tetradeuterio-4-methoxybenzene |
| InChIKey | YRGAYAGBVIXNAQ-QFFDRWTDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1OC)[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)