Products 1219804-96-2
CAS 1219804-96-2 appears in our catalog under these names: Methyl Undecanoate-d21, 98 atom % D, min 98% Chemical Purity, Methyl undecanoate-d21. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,1g, 5mg, 1mg.
Methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosadeuterioundecanoate (CAS 1219804-96-2) is a chemical compound with the molecular formula C12H24O2 and a molecular weight of 221.45 g/mol. IUPAC name: methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosadeuterioundecanoate. InChIKey: XPQPWPZFBULGKT-RQTTZOOMSA-N.
| Molecular formula | C12H24O2 |
|---|---|
| Molecular weight | 221.45 g/mol |
| IUPAC name | methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosadeuterioundecanoate |
| InChIKey | XPQPWPZFBULGKT-RQTTZOOMSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
methyl undecanoate-d21