CAS 1219804-97-3 appears in our catalog under these names: Mianserin-d3 HCl, (±)-Mianserin-d3 Hydrochloride (methyl-d3), >95% (HPLC), (±)-Mianserin-d3 HCl (methyl-d3), >95% (HPLC), (±)-Mianserin-d3 HCl (methyl-d3), 99 atom % D, min 98% Chemical Purity, Mianserin–d3 hydrochloride. Offered by: Chemat Brand, TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: on request, 0,5mg, 1mg, 5mg, 0,05g, 0,01g, 1 mg, 5 mg.
5-(trideuteriomethyl)-2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),8,10,12,15,17-hexaene;hydrochloride (CAS 1219804-97-3) is a chemical compound with the molecular formula C18H21ClN2 and a molecular weight of 303.8 g/mol. IUPAC name: 5-(trideuteriomethyl)-2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),8,10,12,15,17-hexaene;hydrochloride. InChIKey: YNPFMWCWRVTGKJ-NIIDSAIPSA-N.
| Molecular formula | C18H21ClN2 |
|---|---|
| Molecular weight | 303.8 g/mol |
| IUPAC name | 5-(trideuteriomethyl)-2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),8,10,12,15,17-hexaene;hydrochloride |
| InChIKey | YNPFMWCWRVTGKJ-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])N1CCN2C(C1)C3=CC=CC=C3CC4=CC=CC=C42.Cl |
Computed by PubChem (NCBI)