CAS 1219805-09-0 appears in our catalog under these names: (±)-Ibuprofen-d3, Sodium Salt (alpha-methyl-d3), 99 atom % D, min 98% Chemical Purity, (±)–Ibuprofen–d3 (sodium salt), Ibuprofen-d3 (sodium), 99.21%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 10mg, 25mg, 5mg, 50mg, 1 mg, 10 mg.
Sodium 3,3,3-trideuterio-2-[4-(2-methylpropyl)phenyl]propanoate (CAS 1219805-09-0) is a chemical compound with the molecular formula C13H17NaO2 and a molecular weight of 231.28 g/mol. IUPAC name: sodium 3,3,3-trideuterio-2-[4-(2-methylpropyl)phenyl]propanoate. InChIKey: PTTPUWGBPLLBKW-FJCVKDQNSA-M.
| Molecular formula | C13H17NaO2 |
|---|---|
| Molecular weight | 231.28 g/mol |
| IUPAC name | sodium 3,3,3-trideuterio-2-[4-(2-methylpropyl)phenyl]propanoate |
| InChIKey | PTTPUWGBPLLBKW-FJCVKDQNSA-M |
| SMILES | [2H]C([2H])([2H])C(C1=CC=C(C=C1)CC(C)C)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)