Products 1219805-23-8
CAS 1219805-23-8 appears in our catalog under these names: p-Tolualdehyde-d7 (2,3,5,6-d4, methyl-d3), 98 atom % D, min 96% Chemical Purity, p-Tolualdehyde-d7, 98.2%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 100 mg, 5 mg, 25 mg, 50 mg, 10 mg.
2,3,5,6-tetradeuterio-4-(trideuteriomethyl)benzaldehyde (CAS 1219805-23-8) is a chemical compound with the molecular formula C8H8O and a molecular weight of 127.19 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-(trideuteriomethyl)benzaldehyde. InChIKey: FXLOVSHXALFLKQ-AAYPNNLASA-N.
| Molecular formula | C8H8O |
|---|---|
| Molecular weight | 127.19 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-(trideuteriomethyl)benzaldehyde |
| InChIKey | FXLOVSHXALFLKQ-AAYPNNLASA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C=O)[2H])[2H])C([2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)