Products 1219805-25-0
CAS 1219805-25-0 appears in our catalog under these names: Glyceryl Tri(dodecanoate-11,11,12,12,12-d5), 99 atom % D, min 98% Chemical Purity, Trilaurin–d15, Trilaurin-d15, 99.33%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 10mg, 5mg, 10 mg.
2,3-bis(11,11,12,12,12-pentadeuteriododecanoyloxy)propyl 11,11,12,12,12-pentadeuteriododecanoate (CAS 1219805-25-0) is a chemical compound with the molecular formula C39H74O6 and a molecular weight of 654.1 g/mol. IUPAC name: 2,3-bis(11,11,12,12,12-pentadeuteriododecanoyloxy)propyl 11,11,12,12,12-pentadeuteriododecanoate. InChIKey: VMPHSYLJUKZBJJ-NLBPYYKNSA-N.
| Molecular formula | C39H74O6 |
|---|---|
| Molecular weight | 654.1 g/mol |
| IUPAC name | 2,3-bis(11,11,12,12,12-pentadeuteriododecanoyloxy)propyl 11,11,12,12,12-pentadeuteriododecanoate |
| InChIKey | VMPHSYLJUKZBJJ-NLBPYYKNSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])CCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCC([2H])([2H])C([2H])([2H])[2H])OC(=O)CCCCCCCCCC([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)