CAS 1219805-27-2 is the registry number for 4-iso-Propylphenol-d12, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.
1,2,4,5-tetradeuterio-3-deuteriooxy-6-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)benzene (CAS 1219805-27-2) is a chemical compound with the molecular formula C9H12O and a molecular weight of 148.26 g/mol. IUPAC name: 1,2,4,5-tetradeuterio-3-deuteriooxy-6-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)benzene. InChIKey: YQUQWHNMBPIWGK-SRQDVOKDSA-N.
| Molecular formula | C9H12O |
|---|---|
| Molecular weight | 148.26 g/mol |
| IUPAC name | 1,2,4,5-tetradeuterio-3-deuteriooxy-6-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)benzene |
| InChIKey | YQUQWHNMBPIWGK-SRQDVOKDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])[2H])[2H])O[2H])[2H] |
Computed by PubChem (NCBI)