Products 1219805-43-2
CAS 1219805-43-2 appears in our catalog under these names: 2-Phenylethyl Acetate-d3, 99 atom % D, min 98% Chemical Purity, Phenethyl acetate-d3. Offered by: CDN, MedChemExpress. Available pack sizes: 1g, 0,5g, 1 mg.
2-phenylethyl 2,2,2-trideuterioacetate (CAS 1219805-43-2) is a chemical compound with the molecular formula C10H12O2 and a molecular weight of 167.22 g/mol. IUPAC name: 2-phenylethyl 2,2,2-trideuterioacetate. InChIKey: MDHYEMXUFSJLGV-FIBGUPNXSA-N.
| Molecular formula | C10H12O2 |
|---|---|
| Molecular weight | 167.22 g/mol |
| IUPAC name | 2-phenylethyl 2,2,2-trideuterioacetate |
| InChIKey | MDHYEMXUFSJLGV-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)OCCC1=CC=CC=C1 |
Computed by PubChem (NCBI)