CAS 1219805-46-5 appears in our catalog under these names: 1,4-Butane-d8-dithiol, 99 atom % D, min 98% Chemical Purity, 1,4-bUtanedithiol-d8. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 1 mg.
1,1,2,2,3,3,4,4-octadeuteriobutane-1,4-dithiol (CAS 1219805-46-5) is a chemical compound with the molecular formula C4H10S2 and a molecular weight of 130.3 g/mol. IUPAC name: 1,1,2,2,3,3,4,4-octadeuteriobutane-1,4-dithiol. InChIKey: SMTOKHQOVJRXLK-SVYQBANQSA-N.
| Molecular formula | C4H10S2 |
|---|---|
| Molecular weight | 130.3 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4-octadeuteriobutane-1,4-dithiol |
| InChIKey | SMTOKHQOVJRXLK-SVYQBANQSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])C([2H])([2H])S)C([2H])([2H])S |
Computed by PubChem (NCBI)