Products 1219805-54-5
CAS 1219805-54-5 is the registry number for 2,4,6-Trimethylpyridine-d11, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.
3,5-dideuterio-2,4,6-tris(trideuteriomethyl)pyridine (CAS 1219805-54-5) is a chemical compound with the molecular formula C8H11N and a molecular weight of 132.25 g/mol. IUPAC name: 3,5-dideuterio-2,4,6-tris(trideuteriomethyl)pyridine. InChIKey: BWZVCCNYKMEVEX-JXCHDVSKSA-N.
| Molecular formula | C8H11N |
|---|---|
| Molecular weight | 132.25 g/mol |
| IUPAC name | 3,5-dideuterio-2,4,6-tris(trideuteriomethyl)pyridine |
| InChIKey | BWZVCCNYKMEVEX-JXCHDVSKSA-N |
| SMILES | [2H]C1=C(C(=C(N=C1C([2H])([2H])[2H])C([2H])([2H])[2H])[2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)