CAS 1219805-55-6 is the registry number for Bis(3-aminopropyl-d6)amine, 98 atom % D, min 97% Chemical Purity. Offered by: CDN. Available pack sizes: 0,05g, 0,01g.
N'-(3-amino-1,1,2,2,3,3-hexadeuteriopropyl)-1,1,2,2,3,3-hexadeuteriopropane-1,3-diamine (CAS 1219805-55-6) is a chemical compound with the molecular formula C6H17N3 and a molecular weight of 143.29 g/mol. IUPAC name: N'-(3-amino-1,1,2,2,3,3-hexadeuteriopropyl)-1,1,2,2,3,3-hexadeuteriopropane-1,3-diamine. InChIKey: OTBHHUPVCYLGQO-LBTWDOQPSA-N.
| Molecular formula | C6H17N3 |
|---|---|
| Molecular weight | 143.29 g/mol |
| IUPAC name | N'-(3-amino-1,1,2,2,3,3-hexadeuteriopropyl)-1,1,2,2,3,3-hexadeuteriopropane-1,3-diamine |
| InChIKey | OTBHHUPVCYLGQO-LBTWDOQPSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])N)C([2H])([2H])NC([2H])([2H])C([2H])([2H])C([2H])([2H])N |
Computed by PubChem (NCBI)