Products 1219805-71-6
CAS 1219805-71-6 appears in our catalog under these names: Butyryl-d7 Chloride, Butyryl-d7 Chloride, 98 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 100mg, 250mg, 50mg, 1g, 0,5g.
2,2,3,3,4,4,4-heptadeuteriobutanoyl chloride (CAS 1219805-71-6) is a chemical compound with the molecular formula C4H7ClO and a molecular weight of 113.59 g/mol. IUPAC name: 2,2,3,3,4,4,4-heptadeuteriobutanoyl chloride. InChIKey: DVECBJCOGJRVPX-NCKGIQLSSA-N.
| Molecular formula | C4H7ClO |
|---|---|
| Molecular weight | 113.59 g/mol |
| IUPAC name | 2,2,3,3,4,4,4-heptadeuteriobutanoyl chloride |
| InChIKey | DVECBJCOGJRVPX-NCKGIQLSSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)Cl |
Computed by PubChem (NCBI)