CAS 1219805-72-7 appears in our catalog under these names: 3-Hydroxyglutaric Acid-d5, 3-Hydroxy-1,5-pentanedioic-2,2,3,4,4-d5 Acid, 98 atom % D, min 98% Chemical Purity, 3–Hydroxyglutaric acid–d5, 3-Hydroxyglutaric acid-d5, 99.72%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 50mg, 0,05g, 0,01g, 1mg, 5mg, 1 mg, 5 mg.
2,2,3,4,4-pentadeuterio-3-hydroxypentanedioic acid (CAS 1219805-72-7) is a chemical compound with the molecular formula C5H8O5 and a molecular weight of 153.14 g/mol. IUPAC name: 2,2,3,4,4-pentadeuterio-3-hydroxypentanedioic acid. InChIKey: ZQHYXNSQOIDNTL-UXXIZXEISA-N.
| Molecular formula | C5H8O5 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | 2,2,3,4,4-pentadeuterio-3-hydroxypentanedioic acid |
| InChIKey | ZQHYXNSQOIDNTL-UXXIZXEISA-N |
| SMILES | [2H]C([2H])(C(=O)O)C([2H])(C([2H])([2H])C(=O)O)O |
Computed by PubChem (NCBI)