CAS 1219805-75-0 appears in our catalog under these names: (±)-Chlorophacinone-d4 (indanedione-d4), >95% (HPLC), (±)-Chlorophacinone-d4 (indanedione-d4), 99 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 10mg, 0,01g.
2-[2-(4-chlorophenyl)-2-phenylacetyl]-4,5,6,7-tetradeuterioindene-1,3-dione (CAS 1219805-75-0) is a chemical compound with the molecular formula C23H15ClO3 and a molecular weight of 378.8 g/mol. IUPAC name: 2-[2-(4-chlorophenyl)-2-phenylacetyl]-4,5,6,7-tetradeuterioindene-1,3-dione. InChIKey: UDHXJZHVNHGCEC-DOGSKSIHSA-N.
| Molecular formula | C23H15ClO3 |
|---|---|
| Molecular weight | 378.8 g/mol |
| IUPAC name | 2-[2-(4-chlorophenyl)-2-phenylacetyl]-4,5,6,7-tetradeuterioindene-1,3-dione |
| InChIKey | UDHXJZHVNHGCEC-DOGSKSIHSA-N |
| SMILES | [2H]C1=C(C(=C2C(=O)C(C(=O)C2=C1[2H])C(=O)C(C3=CC=CC=C3)C4=CC=C(C=C4)Cl)[2H])[2H] |
Computed by PubChem (NCBI)