CAS 1219805-82-9 appears in our catalog under these names: N-Acetylglycine-d5, >95% (HPLC), N-Acetyl-d3-glycine-2,2-d2, 98 atom % D, min 98% Chemical Purity, N–Acetylglycine–d5, N-Acetylglycine-d5, 95.44%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 100mg, 250mg, 25mg, 0,25g, 0,1g, 5mg, 10 mg, 5 mg.
2,2-dideuterio-2-[(2,2,2-trideuterioacetyl)amino]acetic acid (CAS 1219805-82-9) is a chemical compound with the molecular formula C4H7NO3 and a molecular weight of 122.13 g/mol. IUPAC name: 2,2-dideuterio-2-[(2,2,2-trideuterioacetyl)amino]acetic acid. InChIKey: OKJIRPAQVSHGFK-ZBJDZAJPSA-N.
| Molecular formula | C4H7NO3 |
|---|---|
| Molecular weight | 122.13 g/mol |
| IUPAC name | 2,2-dideuterio-2-[(2,2,2-trideuterioacetyl)amino]acetic acid |
| InChIKey | OKJIRPAQVSHGFK-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)NC([2H])([2H])C(=O)O |
Computed by PubChem (NCBI)