Products 1219805-87-4
CAS 1219805-87-4 appears in our catalog under these names: 1,3-Dibromo-5-fluorobenzene-d3, 98 atom % D, min 98% Chemical Purity, 1,3-Dibromo-5-fluorobenzene-d3. Offered by: CDN, MedChemExpress. Available pack sizes: 1g, 0,5g, 1 mg.
1,3-dibromo-2,4,6-trideuterio-5-fluorobenzene (CAS 1219805-87-4) is a chemical compound with the molecular formula C6H3Br2F and a molecular weight of 256.91 g/mol. IUPAC name: 1,3-dibromo-2,4,6-trideuterio-5-fluorobenzene. InChIKey: ASWYHZXKFSLNLN-CBYSEHNBSA-N.
| Molecular formula | C6H3Br2F |
|---|---|
| Molecular weight | 256.91 g/mol |
| IUPAC name | 1,3-dibromo-2,4,6-trideuterio-5-fluorobenzene |
| InChIKey | ASWYHZXKFSLNLN-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1Br)[2H])Br)[2H])F |
Computed by PubChem (NCBI)