Products 1219908-93-6
CAS 1219908-93-6 is the registry number for 2-Chloro-N,N-diethylethyl-d4-amine. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 50mg, 100mg.
2-chloro-1,1,2,2-tetradeuterio-N,N-diethylethanamine (CAS 1219908-93-6) is a chemical compound with the molecular formula C6H14ClN and a molecular weight of 139.66 g/mol. IUPAC name: 2-chloro-1,1,2,2-tetradeuterio-N,N-diethylethanamine. InChIKey: YMDNODNLFSHHCV-NZLXMSDQSA-N.
| Molecular formula | C6H14ClN |
|---|---|
| Molecular weight | 139.66 g/mol |
| IUPAC name | 2-chloro-1,1,2,2-tetradeuterio-N,N-diethylethanamine |
| InChIKey | YMDNODNLFSHHCV-NZLXMSDQSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])Cl)N(CC)CC |
Computed by PubChem (NCBI)