CAS 1219940-12-1 appears in our catalog under these names: 1-(4-Chlorophenyl)ethylidene(methoxy)amine, 98%, 1-(4-Chlorophenyl)ethanone O-methyl oxime. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g.
(E)-1-(4-chlorophenyl)-N-methoxyethanimine (CAS 1219940-12-1) is a chemical compound with the molecular formula C9H10ClNO and a molecular weight of 183.63 g/mol. IUPAC name: (E)-1-(4-chlorophenyl)-N-methoxyethanimine. InChIKey: DJJNNRDIXWZGPE-YRNVUSSQSA-N.
| Molecular formula | C9H10ClNO |
|---|---|
| Molecular weight | 183.63 g/mol |
| IUPAC name | (E)-1-(4-chlorophenyl)-N-methoxyethanimine |
| InChIKey | DJJNNRDIXWZGPE-YRNVUSSQSA-N |
| SMILES | C/C(=N\OC)/C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)