CAS 1219945-17-1 is the registry number for 2-(6-Fluoro-1h-indol-3-yl)-2-methylpropan-1-amine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-(6-fluoro-1H-indol-3-yl)-2-methylpropan-1-amine (CAS 1219945-17-1) is a chemical compound with the molecular formula C12H15FN2 and a molecular weight of 206.26 g/mol. IUPAC name: 2-(6-fluoro-1H-indol-3-yl)-2-methylpropan-1-amine. InChIKey: QLCZEPVFLQULMM-UHFFFAOYSA-N.
| Molecular formula | C12H15FN2 |
|---|---|
| Molecular weight | 206.26 g/mol |
| IUPAC name | 2-(6-fluoro-1H-indol-3-yl)-2-methylpropan-1-amine |
| InChIKey | QLCZEPVFLQULMM-UHFFFAOYSA-N |
| SMILES | CC(C)(CN)C1=CNC2=C1C=CC(=C2)F |
Computed by PubChem (NCBI)