CAS 1219960-66-3 appears in our catalog under these names: 2–(Cyclobutanecarboxamido)–2–methylpropanoic acid, 2-(Cyclobutanecarboxamido)-2-methylpropanoic acid, 97%, 97%, 2-(Cyclobutanecarboxamido)-2-methylpropanoic acid, 97%, N-(cBuCO)-Aib-OH, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 500mg, 100mg.
2-(cyclobutanecarbonylamino)-2-methylpropanoic acid (CAS 1219960-66-3) is a chemical compound with the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. IUPAC name: 2-(cyclobutanecarbonylamino)-2-methylpropanoic acid. InChIKey: CWSSMKIHNJENMC-UHFFFAOYSA-N.
| Molecular formula | C9H15NO3 |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 2-(cyclobutanecarbonylamino)-2-methylpropanoic acid |
| InChIKey | CWSSMKIHNJENMC-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)NC(=O)C1CCC1 |
Computed by PubChem (NCBI)