Products 122-10-1

CAS 122-10-1 is the registry number for Bomyl. Offered by: TRC. Available pack sizes: 100mg, 500mg, 50mg.

Structural formula: {0} (CAS {1})

Dimethyl 3-dimethoxyphosphoryloxypent-2-enedioate (CAS 122-10-1) is a chemical compound with the molecular formula C9H15O8P and a molecular weight of 282.18 g/mol. IUPAC name: dimethyl 3-dimethoxyphosphoryloxypent-2-enedioate. InChIKey: BZSSHIWHSJYWAD-UHFFFAOYSA-N.

Identity
Molecular formulaC9H15O8P
Molecular weight282.18 g/mol
IUPAC namedimethyl 3-dimethoxyphosphoryloxypent-2-enedioate
InChIKeyBZSSHIWHSJYWAD-UHFFFAOYSA-N
SMILESCOC(=O)CC(=CC(=O)OC)OP(=O)(OC)OC

Computed by PubChem (NCBI)