Products 1220019-17-9
CAS 1220019-17-9 appears in our catalog under these names: 1-(4-Amino-2-(trifluoromethyl)phenyl)pyrrolidin-3-ol, 95+%, 1-(4-Amino-2-(trifluoromethyl)phenyl)pyrrolidin-3-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1-[4-amino-2-(trifluoromethyl)phenyl]pyrrolidin-3-ol (CAS 1220019-17-9) is a chemical compound with the molecular formula C11H13F3N2O and a molecular weight of 246.23 g/mol. IUPAC name: 1-[4-amino-2-(trifluoromethyl)phenyl]pyrrolidin-3-ol. InChIKey: DWGVBUOKDUXKOM-UHFFFAOYSA-N.
| Molecular formula | C11H13F3N2O |
|---|---|
| Molecular weight | 246.23 g/mol |
| IUPAC name | 1-[4-amino-2-(trifluoromethyl)phenyl]pyrrolidin-3-ol |
| InChIKey | DWGVBUOKDUXKOM-UHFFFAOYSA-N |
| SMILES | C1CN(CC1O)C2=C(C=C(C=C2)N)C(F)(F)F |
Computed by PubChem (NCBI)