Products 1220027-57-5

CAS 1220027-57-5 is the registry number for 2-Amino-n-isopropyl-2-methylpropanamide hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2-amino-2-methyl-N-propan-2-ylpropanamide;hydrochloride (CAS 1220027-57-5) is a chemical compound with the molecular formula C7H17ClN2O and a molecular weight of 180.67 g/mol. IUPAC name: 2-amino-2-methyl-N-propan-2-ylpropanamide;hydrochloride. InChIKey: KGKYQVTZHCCNKT-UHFFFAOYSA-N.

Identity
Molecular formulaC7H17ClN2O
Molecular weight180.67 g/mol
IUPAC name2-amino-2-methyl-N-propan-2-ylpropanamide;hydrochloride
InChIKeyKGKYQVTZHCCNKT-UHFFFAOYSA-N
SMILESCC(C)NC(=O)C(C)(C)N.Cl

Computed by PubChem (NCBI)