Products 1220029-21-9
CAS 1220029-21-9 is the registry number for 3-chloro-N,N-diethyl-5-(trifluoromethyl)pyridin-2-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-chloro-N,N-diethyl-5-(trifluoromethyl)pyridin-2-amine (CAS 1220029-21-9) is a chemical compound with the molecular formula C10H12ClF3N2 and a molecular weight of 252.66 g/mol. IUPAC name: 3-chloro-N,N-diethyl-5-(trifluoromethyl)pyridin-2-amine. InChIKey: GWDIOLFKLMFJFP-UHFFFAOYSA-N.
| Molecular formula | C10H12ClF3N2 |
|---|---|
| Molecular weight | 252.66 g/mol |
| IUPAC name | 3-chloro-N,N-diethyl-5-(trifluoromethyl)pyridin-2-amine |
| InChIKey | GWDIOLFKLMFJFP-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=C(C=C(C=N1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)