CAS 1220124-43-5 is the registry number for (3-Bromophenyl)(3-(trifluoromethyl)phenyl)methanone. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
(3-bromophenyl)-[3-(trifluoromethyl)phenyl]methanone (CAS 1220124-43-5) is a chemical compound with the molecular formula C14H8BrF3O and a molecular weight of 329.11 g/mol. IUPAC name: (3-bromophenyl)-[3-(trifluoromethyl)phenyl]methanone. InChIKey: ZGLXSWHFUWZJFJ-UHFFFAOYSA-N.
| Molecular formula | C14H8BrF3O |
|---|---|
| Molecular weight | 329.11 g/mol |
| IUPAC name | (3-bromophenyl)-[3-(trifluoromethyl)phenyl]methanone |
| InChIKey | ZGLXSWHFUWZJFJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C(=O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)