Products 1220188-40-8
CAS 1220188-40-8 appears in our catalog under these names: 2-Carboxyfuran-5-boronic acid, pinacol ester, 96%, 2-Carboxyfuran-5-boronic acid, pinacol ester. Offered by: Combi-blocks, TRC. Available pack sizes: 1g, 10g, 5g.
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-carboxylic acid (CAS 1220188-40-8) is a chemical compound with the molecular formula C11H15BO5 and a molecular weight of 238.05 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-carboxylic acid. InChIKey: GQNVIDPLCCFIIN-UHFFFAOYSA-N.
| Molecular formula | C11H15BO5 |
|---|---|
| Molecular weight | 238.05 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-carboxylic acid |
| InChIKey | GQNVIDPLCCFIIN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(O2)C(=O)O |
Computed by PubChem (NCBI)