CAS 1220229-87-7 appears in our catalog under these names: 6-Bromo-1-oxo-1,2-dihydroisoquinoline-4-sulfonyl chloride, 97%, 6-Bromo-1-oxo-1,2-dihydroisoquinoline-4-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 10g, 0,5g, 50mg.
6-bromo-1-oxo-2H-isoquinoline-4-sulfonyl chloride (CAS 1220229-87-7) is a chemical compound with the molecular formula C9H5BrClNO3S and a molecular weight of 322.56 g/mol. IUPAC name: 6-bromo-1-oxo-2H-isoquinoline-4-sulfonyl chloride. InChIKey: FTJUXLZAEKFPGR-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClNO3S |
|---|---|
| Molecular weight | 322.56 g/mol |
| IUPAC name | 6-bromo-1-oxo-2H-isoquinoline-4-sulfonyl chloride |
| InChIKey | FTJUXLZAEKFPGR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=CNC2=O)S(=O)(=O)Cl |
Computed by PubChem (NCBI)