Products 1220422-59-2
CAS 1220422-59-2 is the registry number for tert-Butyl 2-(3-bromophenylsulfonyl)-acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Tert-butyl 2-(3-bromophenyl)sulfonylacetate (CAS 1220422-59-2) is a chemical compound with the molecular formula C12H15BrO4S and a molecular weight of 335.22 g/mol. IUPAC name: tert-butyl 2-(3-bromophenyl)sulfonylacetate. InChIKey: RCKAAAJQDWWUMR-UHFFFAOYSA-N.
| Molecular formula | C12H15BrO4S |
|---|---|
| Molecular weight | 335.22 g/mol |
| IUPAC name | tert-butyl 2-(3-bromophenyl)sulfonylacetate |
| InChIKey | RCKAAAJQDWWUMR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CS(=O)(=O)C1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)