Products 1220515-87-6
CAS 1220515-87-6 is the registry number for 3'-ONH2-dATP. Offered by: MedChemExpress. Available pack sizes: Get quote.
[[(2R,3S,5R)-3-aminooxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (CAS 1220515-87-6) is a chemical compound with the molecular formula C10H17N6O12P3 and a molecular weight of 506.20 g/mol. IUPAC name: [[(2R,3S,5R)-3-aminooxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate. InChIKey: JRWRMKPKCJGCKT-RRKCRQDMSA-N.
| Molecular formula | C10H17N6O12P3 |
|---|---|
| Molecular weight | 506.20 g/mol |
| IUPAC name | [[(2R,3S,5R)-3-aminooxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| InChIKey | JRWRMKPKCJGCKT-RRKCRQDMSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=NC3=C(N=CN=C32)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)ON |
Computed by PubChem (NCBI)