Products 122080-97-1
CAS 122080-97-1 is the registry number for 5-methyl-2-tosyl-2-aza-bicyclo[3.2.0]heptan-7-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
5-methyl-2-(4-methylphenyl)sulfonyl-2-azabicyclo[3.2.0]heptan-7-one (CAS 122080-97-1) is a chemical compound with the molecular formula C14H17NO3S and a molecular weight of 279.36 g/mol. IUPAC name: 5-methyl-2-(4-methylphenyl)sulfonyl-2-azabicyclo[3.2.0]heptan-7-one. InChIKey: IIMVJHYPPFMQEH-UHFFFAOYSA-N.
| Molecular formula | C14H17NO3S |
|---|---|
| Molecular weight | 279.36 g/mol |
| IUPAC name | 5-methyl-2-(4-methylphenyl)sulfonyl-2-azabicyclo[3.2.0]heptan-7-one |
| InChIKey | IIMVJHYPPFMQEH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCC3(C2C(=O)C3)C |
Computed by PubChem (NCBI)