Products 1220965-73-0
CAS 1220965-73-0 is the registry number for PDHK-IN-7. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[1-(2-hydroxyethyl)pyrazol-4-yl]-2-methyl-9-(trifluoromethyl)fluoren-9-ol (CAS 1220965-73-0) is a chemical compound with the molecular formula C20H17F3N2O2 and a molecular weight of 374.4 g/mol. IUPAC name: 4-[1-(2-hydroxyethyl)pyrazol-4-yl]-2-methyl-9-(trifluoromethyl)fluoren-9-ol. InChIKey: YEUDACDOZNWCHD-UHFFFAOYSA-N.
| Molecular formula | C20H17F3N2O2 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | 4-[1-(2-hydroxyethyl)pyrazol-4-yl]-2-methyl-9-(trifluoromethyl)fluoren-9-ol |
| InChIKey | YEUDACDOZNWCHD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C3=CC=CC=C3C(C2=C1)(C(F)(F)F)O)C4=CN(N=C4)CCO |
Computed by PubChem (NCBI)