CAS 1220968-00-2 is the registry number for Ethyl 4-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)butanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]butanoate (CAS 1220968-00-2) is a chemical compound with the molecular formula C15H25BN2O4 and a molecular weight of 308.18 g/mol. IUPAC name: ethyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]butanoate. InChIKey: NICCYRFAIKKAKV-UHFFFAOYSA-N.
| Molecular formula | C15H25BN2O4 |
|---|---|
| Molecular weight | 308.18 g/mol |
| IUPAC name | ethyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]butanoate |
| InChIKey | NICCYRFAIKKAKV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)CCCC(=O)OCC |
Computed by PubChem (NCBI)