CAS 122111-02-8 appears in our catalog under these names: Gemcitabine Impurity 5, 2-Deoxy-2,2-difluoro-D-threo-pentofuranos-1-ulose-3,5-dibenzoate. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 100mg, 50mg.
[(2R)-3-benzoyloxy-4,4-difluoro-5-oxooxolan-2-yl]methyl benzoate (CAS 122111-02-8) is a chemical compound with the molecular formula C19H14F2O6 and a molecular weight of 376.3 g/mol. IUPAC name: [(2R)-3-benzoyloxy-4,4-difluoro-5-oxooxolan-2-yl]methyl benzoate. InChIKey: SHHNEUNVMZNOID-GICMACPYSA-N.
| Molecular formula | C19H14F2O6 |
|---|---|
| Molecular weight | 376.3 g/mol |
| IUPAC name | [(2R)-3-benzoyloxy-4,4-difluoro-5-oxooxolan-2-yl]methyl benzoate |
| InChIKey | SHHNEUNVMZNOID-GICMACPYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC[C@@H]2C(C(C(=O)O2)(F)F)OC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)