CAS 1221160-67-3 appears in our catalog under these names: Ramelteon Impurity 16, N-Ooxopropane Ramelteon Dimer. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg.
N,N-bis[2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]ethyl]propanamide (CAS 1221160-67-3) is a chemical compound with the molecular formula C29H35NO3 and a molecular weight of 445.6 g/mol. IUPAC name: N,N-bis[2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]ethyl]propanamide. InChIKey: AOENYNWBEGLTBW-VXKWHMMOSA-N.
| Molecular formula | C29H35NO3 |
|---|---|
| Molecular weight | 445.6 g/mol |
| IUPAC name | N,N-bis[2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]ethyl]propanamide |
| InChIKey | AOENYNWBEGLTBW-VXKWHMMOSA-N |
| SMILES | CCC(=O)N(CC[C@@H]1CCC2=C1C3=C(C=C2)OCC3)CC[C@@H]4CCC5=C4C6=C(C=C5)OCC6 |
Computed by PubChem (NCBI)