Products 1221171-94-3
CAS 1221171-94-3 appears in our catalog under these names: 2–(Trifluoromethoxy)pyridin–3–amine, 2-(Trifluoromethoxy)pyridin-3-amine, 96%, 96%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 10mg, 250mg.
2-(trifluoromethoxy)pyridin-3-amine (CAS 1221171-94-3) is a chemical compound with the molecular formula C6H5F3N2O and a molecular weight of 178.11 g/mol. IUPAC name: 2-(trifluoromethoxy)pyridin-3-amine. InChIKey: CUEOPNNIXGYENY-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2O |
|---|---|
| Molecular weight | 178.11 g/mol |
| IUPAC name | 2-(trifluoromethoxy)pyridin-3-amine |
| InChIKey | CUEOPNNIXGYENY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)OC(F)(F)F)N |
Computed by PubChem (NCBI)