CAS 1221184-53-7 is the registry number for 1,2–di(3–thienyl)benzene. Offered by: GLPBio. Available pack sizes: 250mg, 50mg.
3-(2-thiophen-3-ylphenyl)thiophene (CAS 1221184-53-7) is a chemical compound with the molecular formula C14H10S2 and a molecular weight of 242.4 g/mol. IUPAC name: 3-(2-thiophen-3-ylphenyl)thiophene. InChIKey: ZOYNWUCLHBJRRO-UHFFFAOYSA-N.
| Molecular formula | C14H10S2 |
|---|---|
| Molecular weight | 242.4 g/mol |
| IUPAC name | 3-(2-thiophen-3-ylphenyl)thiophene |
| InChIKey | ZOYNWUCLHBJRRO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CSC=C2)C3=CSC=C3 |
Computed by PubChem (NCBI)