Products 1221418-42-3
CAS 1221418-42-3 is the registry number for SAR629, 99.93%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 5 mg, 50 mg, 100 mg, 10mM/1mL.
[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-(1,2,4-triazol-1-yl)methanone (CAS 1221418-42-3) is a chemical compound with the molecular formula C20H19F2N5O and a molecular weight of 383.4 g/mol. IUPAC name: [4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-(1,2,4-triazol-1-yl)methanone. InChIKey: UIOVHJYJUUSVIG-UHFFFAOYSA-N.
| Molecular formula | C20H19F2N5O |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | [4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-(1,2,4-triazol-1-yl)methanone |
| InChIKey | UIOVHJYJUUSVIG-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C(C2=CC=C(C=C2)F)C3=CC=C(C=C3)F)C(=O)N4C=NC=N4 |
Computed by PubChem (NCBI)