CAS 122149-47-7 appears in our catalog under these names: Pemirolast Impurity 5 (Mixture of Z and E Isomers), Pemirolast Impurity 4. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
3-[(3-methyl-2-pyridinyl)amino]-2-(2H-tetrazol-5-yl)prop-2-enoic acid (CAS 122149-47-7) is a chemical compound with the molecular formula C10H10N6O2 and a molecular weight of 246.23 g/mol. IUPAC name: 3-[(3-methyl-2-pyridinyl)amino]-2-(2H-tetrazol-5-yl)prop-2-enoic acid. InChIKey: BJJTYRUGBSZJRZ-UHFFFAOYSA-N.
| Molecular formula | C10H10N6O2 |
|---|---|
| Molecular weight | 246.23 g/mol |
| IUPAC name | 3-[(3-methyl-2-pyridinyl)amino]-2-(2H-tetrazol-5-yl)prop-2-enoic acid |
| InChIKey | BJJTYRUGBSZJRZ-UHFFFAOYSA-N |
| SMILES | CC1=C(N=CC=C1)NC=C(C2=NNN=N2)C(=O)O |
Computed by PubChem (NCBI)