CAS 1221722-19-5 appears in our catalog under these names: 2-(5-tert-Butyl-1,2,4-oxadiazol-3-yl)propan-2-amine hydrochloride, 95%, 2-(5-tert-Butyl-1,2,4-oxadiazol-3-yl)propan-2-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)propan-2-amine;hydrochloride (CAS 1221722-19-5) is a chemical compound with the molecular formula C9H18ClN3O and a molecular weight of 219.71 g/mol. IUPAC name: 2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)propan-2-amine;hydrochloride. InChIKey: JAYLRTRQOVORNJ-UHFFFAOYSA-N.
| Molecular formula | C9H18ClN3O |
|---|---|
| Molecular weight | 219.71 g/mol |
| IUPAC name | 2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)propan-2-amine;hydrochloride |
| InChIKey | JAYLRTRQOVORNJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC(=NO1)C(C)(C)N.Cl |
Computed by PubChem (NCBI)