CAS 1221722-33-3 appears in our catalog under these names: 2-{((dimethyl-4H-1,2,4-triazol-3-yl)methyl)(methyl)amino}acetic acid dihydrochloride, 95%, 2-{((Dimethyl-4H-1,2,4-triazol-3-yl)methyl)(methyl)amino}acetic acid dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl-methylamino]acetic acid;dihydrochloride (CAS 1221722-33-3) is a chemical compound with the molecular formula C8H16Cl2N4O2 and a molecular weight of 271.14 g/mol. IUPAC name: 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl-methylamino]acetic acid;dihydrochloride. InChIKey: MUZIACWFNNXQRQ-UHFFFAOYSA-N.
| Molecular formula | C8H16Cl2N4O2 |
|---|---|
| Molecular weight | 271.14 g/mol |
| IUPAC name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl-methylamino]acetic acid;dihydrochloride |
| InChIKey | MUZIACWFNNXQRQ-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(N1C)CN(C)CC(=O)O.Cl.Cl |
Computed by PubChem (NCBI)