Products 2155855-55-1

CAS 2155855-55-1 is the registry number for Methyl 2-(4-(3-aminopropyl)-1H-1,2,3-triazol-1-yl)acetate dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 2-[4-(3-aminopropyl)triazol-1-yl]acetate;dihydrochloride (CAS 2155855-55-1) is a chemical compound with the molecular formula C8H16Cl2N4O2 and a molecular weight of 271.14 g/mol. IUPAC name: methyl 2-[4-(3-aminopropyl)triazol-1-yl]acetate;dihydrochloride. InChIKey: JYJKZDSARMFUDV-UHFFFAOYSA-N.

Identity
Molecular formulaC8H16Cl2N4O2
Molecular weight271.14 g/mol
IUPAC namemethyl 2-[4-(3-aminopropyl)triazol-1-yl]acetate;dihydrochloride
InChIKeyJYJKZDSARMFUDV-UHFFFAOYSA-N
SMILESCOC(=O)CN1C=C(N=N1)CCCN.Cl.Cl

Computed by PubChem (NCBI)