CAS 1221723-68-7 is the registry number for 4-(4-Fluorophenoxy)benzene-1-carboximidamide hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
4-(4-fluorophenoxy)benzenecarboximidamide;hydrochloride (CAS 1221723-68-7) is a chemical compound with the molecular formula C13H12ClFN2O and a molecular weight of 266.70 g/mol. IUPAC name: 4-(4-fluorophenoxy)benzenecarboximidamide;hydrochloride. InChIKey: RMIPXDHASXQQDE-UHFFFAOYSA-N.
| Molecular formula | C13H12ClFN2O |
|---|---|
| Molecular weight | 266.70 g/mol |
| IUPAC name | 4-(4-fluorophenoxy)benzenecarboximidamide;hydrochloride |
| InChIKey | RMIPXDHASXQQDE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=N)N)OC2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)