CAS 1221725-55-8 is the registry number for 1-((2,5-Difluorophenyl)methyl)-4-methyl-1H-pyrazol-5-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[(2,5-difluorophenyl)methyl]-4-methylpyrazol-5-amine;hydrochloride (CAS 1221725-55-8) is a chemical compound with the molecular formula C11H12ClF2N3 and a molecular weight of 259.68 g/mol. IUPAC name: 1-[(2,5-difluorophenyl)methyl]-4-methylpyrazol-5-amine;hydrochloride. InChIKey: OFDXIAATPBRNIX-UHFFFAOYSA-N.
| Molecular formula | C11H12ClF2N3 |
|---|---|
| Molecular weight | 259.68 g/mol |
| IUPAC name | 1-[(2,5-difluorophenyl)methyl]-4-methylpyrazol-5-amine;hydrochloride |
| InChIKey | OFDXIAATPBRNIX-UHFFFAOYSA-N |
| SMILES | CC1=C(N(N=C1)CC2=C(C=CC(=C2)F)F)N.Cl |
Computed by PubChem (NCBI)