Products 1221725-61-6

CAS 1221725-61-6 is the registry number for 2,2,2-Trifluoroethyl N-(6-(diethylamino)pyridin-3-yl)carbamate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2,2,2-trifluoroethyl N-[6-(diethylamino)-3-pyridinyl]carbamate (CAS 1221725-61-6) is a chemical compound with the molecular formula C12H16F3N3O2 and a molecular weight of 291.27 g/mol. IUPAC name: 2,2,2-trifluoroethyl N-[6-(diethylamino)-3-pyridinyl]carbamate. InChIKey: AJELHUYWTNVSIX-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16F3N3O2
Molecular weight291.27 g/mol
IUPAC name2,2,2-trifluoroethyl N-[6-(diethylamino)-3-pyridinyl]carbamate
InChIKeyAJELHUYWTNVSIX-UHFFFAOYSA-N
SMILESCCN(CC)C1=NC=C(C=C1)NC(=O)OCC(F)(F)F

Computed by PubChem (NCBI)