CAS 1221726-22-2 is the registry number for 3-Amino-4-chloro-N-(2-(dimethylamino)ethyl)benzamide dihydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-amino-4-chloro-N-[2-(dimethylamino)ethyl]benzamide;dihydrochloride (CAS 1221726-22-2) is a chemical compound with the molecular formula C11H18Cl3N3O and a molecular weight of 314.6 g/mol. IUPAC name: 3-amino-4-chloro-N-[2-(dimethylamino)ethyl]benzamide;dihydrochloride. InChIKey: YTDJVQOYNHVKLU-UHFFFAOYSA-N.
| Molecular formula | C11H18Cl3N3O |
|---|---|
| Molecular weight | 314.6 g/mol |
| IUPAC name | 3-amino-4-chloro-N-[2-(dimethylamino)ethyl]benzamide;dihydrochloride |
| InChIKey | YTDJVQOYNHVKLU-UHFFFAOYSA-N |
| SMILES | CN(C)CCNC(=O)C1=CC(=C(C=C1)Cl)N.Cl.Cl |
Computed by PubChem (NCBI)