CAS 1221793-62-9 appears in our catalog under these names: 3-Bromo-5-chloropyridine 1-oxide, 98%, 3-Bromo-5-chloropyridine 1-oxide, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
3-bromo-5-chloro-1-oxidopyridin-1-ium (CAS 1221793-62-9) is a chemical compound with the molecular formula C5H3BrClNO and a molecular weight of 208.44 g/mol. IUPAC name: 3-bromo-5-chloro-1-oxidopyridin-1-ium. InChIKey: PJXHYRWSZICBHI-UHFFFAOYSA-N.
| Molecular formula | C5H3BrClNO |
|---|---|
| Molecular weight | 208.44 g/mol |
| IUPAC name | 3-bromo-5-chloro-1-oxidopyridin-1-ium |
| InChIKey | PJXHYRWSZICBHI-UHFFFAOYSA-N |
| SMILES | C1=C(C=[N+](C=C1Br)[O-])Cl |
Computed by PubChem (NCBI)