CAS 122193-68-4 is the registry number for 3-[2-(Perfluorohexyl)ethoxy]-1,2-epoxypropane, 96%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 50g, 1g, 5g, 25g, 100g.
2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxymethyl)oxirane (CAS 122193-68-4) is a chemical compound with the molecular formula C11H9F13O2 and a molecular weight of 420.17 g/mol. IUPAC name: 2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxymethyl)oxirane. InChIKey: DRSDQADBHIDJCU-UHFFFAOYSA-N.
| Molecular formula | C11H9F13O2 |
|---|---|
| Molecular weight | 420.17 g/mol |
| IUPAC name | 2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxymethyl)oxirane |
| InChIKey | DRSDQADBHIDJCU-UHFFFAOYSA-N |
| SMILES | C1C(O1)COCCC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)