CAS 1221964-50-6 appears in our catalog under these names: PS315, 98%, (Z)-3-(4-Biphenylyl)-5-(4-chlorophenyl)-2-pentenoic acid, PS315. Offered by: Chemat Brand, Biosynth, MedChemExpress. Available pack sizes: on request, 1000mg, Get quote.
(Z)-5-(4-chlorophenyl)-3-(4-phenylphenyl)pent-2-enoic acid (CAS 1221964-50-6) is a chemical compound with the molecular formula C23H19ClO2 and a molecular weight of 362.8 g/mol. IUPAC name: (Z)-5-(4-chlorophenyl)-3-(4-phenylphenyl)pent-2-enoic acid. InChIKey: KXEKGLNMBLODQT-PGMHBOJBSA-N.
| Molecular formula | C23H19ClO2 |
|---|---|
| Molecular weight | 362.8 g/mol |
| IUPAC name | (Z)-5-(4-chlorophenyl)-3-(4-phenylphenyl)pent-2-enoic acid |
| InChIKey | KXEKGLNMBLODQT-PGMHBOJBSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)/C(=C\C(=O)O)/CCC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)