CAS 1222-74-8 appears in our catalog under these names: 2-(1,1'-Biphenyl-4-yloxy)-2-methylpropanoic acid, 95%, 2-((1,1'-Biphenyl)-4-yloxy)-2-methylpropanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-methyl-2-(4-phenylphenoxy)propanoic acid (CAS 1222-74-8) is a chemical compound with the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. IUPAC name: 2-methyl-2-(4-phenylphenoxy)propanoic acid. InChIKey: JSVVPNWVEKYXKU-UHFFFAOYSA-N.
| Molecular formula | C16H16O3 |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | 2-methyl-2-(4-phenylphenoxy)propanoic acid |
| InChIKey | JSVVPNWVEKYXKU-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)OC1=CC=C(C=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)